Chemindex > 56107-02-9
IL ▼
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
| שם המוצר | 4-Chloro-3-nitrobenzophenone |
| שם אנגלי | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
| מולקולרית פורמולה | C13H8ClNO3 |
| משקל מולקולרי | 261.6605 |
| InChl | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| מספר CAS | 56107-02-9 |
| EINECS | 259-995-7 |
| מבנה מולקולרי |  |
| צפיפות | 1.367g/cm3 |
| נקודת ההתוך | 101-107℃ |
| נקודת רתיחה | 386.5°C at 760 mmHg |
| משקל סגולי | 1.623 |
| נקודת הבזק | 203.4°C |
| לחץ אדים | 3.53E-06mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful:; |
| סיכונים קודי | R20/21##Harmful by inhalation and in contact with skin.:; |
| בטיחות תיאור | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 