Chemindex > 65122-45-4
IL ▼
65122-45-4 חומצה פורמית, תרכובת עם 4-[(m-aminophenyl)azo]בנזן-1,3-diamine (1: 1) |
|
| שם המוצר | חומצה פורמית, תרכובת עם 4-[(m-aminophenyl)azo]בנזן-1,3-diamine (1: 1) |
| נרדפות | חומצה פורמית, compd. עם 4-(2-(3-aminophenyl)diazenyl)-1,3-benzenediamine (1: 1); m-פנילאנדיאמין, 4-((m-aminophenyl)azo)-, מונופורמט; חומצה פורמית, compd. עם 4-((3-aminophenyl)azo)-1,3-benzenediamine (1: 1); חומצה פורמית, תרכובת עם 4-(m-aminophenyl)azo)בנזן-1,3-diamine (1: 1); חומצה פורמית - 4-[(E)-(3-aminophenyl)diazenyl]benzene-1,3-diamine (1:1); |
| שם אנגלי | formic acid, compound with 4-[(m-aminophenyl)azo]benzene-1,3-diamine (1:1);Formic acid, compd. with 4-(2-(3-aminophenyl)diazenyl)-1,3-benzenediamine (1:1);m-Phenylenediamine, 4-((m-aminophenyl)azo)-, monoformate;Formic acid, compd. with 4-((3-aminophenyl)azo)-1,3-benzenediamine (1:1);Formic acid, compound with 4-((m-aminophenyl)azo)benzene-1,3-diamine (1:1);formic acid - 4-[(E)-(3-aminophenyl)diazenyl]benzene-1,3-diamine (1:1) |
| מולקולרית פורמולה | C13H15N5O2 |
| משקל מולקולרי | 273.2905 |
| InChl | InChI=1/C12H13N5.CH2O2/c13-8-2-1-3-10(6-8)16-17-12-5-4-9(14)7-11(12)15;2-1-3/h1-7H,13-15H2;1H,(H,2,3)/b17-16+; |
| מספר CAS | 65122-45-4 |
| EINECS | 265-490-2 |
| מבנה מולקולרי | ![65122-45-4 חומצה פורמית, תרכובת עם 4-[(m-aminophenyl)azo]בנזן-1,3-diamine (1: 1)](https://images-a.chemnet.com/suppliers/chembase/cas6/cas65122-45-4.gif "65122-45-4 חומצה פורמית, תרכובת עם 4-[(m-aminophenyl)azo]בנזן-1,3-diamine (1: 1)") |
| נקודת רתיחה | 521.3°C at 760 mmHg |
| נקודת הבזק | 269.1°C |
| לחץ אדים | 5.76E-11mmHg at 25°C |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 65122-45-4 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 