ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70682-65-4 O,O-bis(sec-butyl) מימן dithiophosphate, תרכובת עם dicyclohexylamine (1: 1) |
|
שם המוצר | O,O-bis(sec-butyl) מימן dithiophosphate, תרכובת עם dicyclohexylamine (1: 1) |
נרדפות | חומצה פוספורודיתיואית, O,O-bis(1-methylpropyl) אסטר, compd.עם N-cyclohexylcyclohexanamine (1: 1); O,O-Bis(1-methylpropyl) dithiophosphate, מלח dicyclohexylamine; O,O-Bis(sec-butyl) מימן dithiophosphate, תרכובת עם dicyclohexylamine (1: 1); O,O-dibutan-2-yl מימן פוספורודיתיואט - N-cyclohexylcyclohexanamine (1: 1); |
שם אנגלי | O,O-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);Phosphorodithioic acid, O,O-bis(1-methylpropyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1);O,O-Bis(1-methylpropyl) dithiophosphate, dicyclohexylamine salt;O,O-Bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);O,O-dibutan-2-yl hydrogen phosphorodithioate - N-cyclohexylcyclohexanamine (1:1) |
מולקולרית פורמולה | C20H42NO2PS2 |
משקל מולקולרי | 423.6567 |
InChl | InChI=1/C12H23N.C8H19O2PS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3)9-11(12,13)10-8(4)6-2/h11-13H,1-10H2;7-8H,5-6H2,1-4H3,(H,12,13) |
מספר CAS | 70682-65-4 |
EINECS | 274-745-7 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 256.1°C at 760 mmHg |
נקודת הבזק | 96.1°C |
לחץ אדים | 0.0157mmHg at 25°C |
MSDS |