ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
| שם המוצר | Bromodichloromethane |
| שם אנגלי | Bromodichloromethane;FC-20B1 |
| מולקולרית פורמולה | CHBrCl2 |
| משקל מולקולרי | 163.8286 |
| InChl | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| מספר CAS | 75-27-4 |
| EINECS | 200-856-7 |
| מבנה מולקולרי | ![]() |
| צפיפות | 2.013g/cm3 |
| נקודת ההתוך | -55℃ |
| נקודת רתיחה | 89.7°C at 760 mmHg |
| משקל סגולי | 1.503 |
| נקודת הבזק | 1.3°C |
| לחץ אדים | 65.3mmHg at 25°C |
| Hazard סימנים | |
| סיכונים קודי | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| בטיחות תיאור | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |