ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
שם המוצר | 3,5-Dimethylphenylthiourea |
שם אנגלי | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
מולקולרית פורמולה | C9H12N2S |
משקל מולקולרי | 180.27 |
InChl | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
מספר CAS | 97480-60-9 |
מבנה מולקולרי | ![]() |
צפיפות | 1.2g/cm3 |
נקודת רתיחה | 293.9°C at 760 mmHg |
משקל סגולי | 1.674 |
נקודת הבזק | 131.5°C |
לחץ אדים | 0.00168mmHg at 25°C |
סיכונים קודי | R25##Toxic if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |