ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
|
उत्पाद का नाम | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
अंग्रेज | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
आणविक फार्मूला | C10H7Cl2NS |
आण्विक वजन | 244.1403 |
InChI | InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
कैस रजिस्टी संख्या | 17969-22-1 |
आणविक संरचना | ![]() |
घनत्व | 1.378g/cm3 |
गलनांक | 78℃ |
उबलने का समय | 374°C at 760 mmHg |
अपवर्तक सूचकांक | 1.617 |
फ्लैश प्वाइंट | 180°C |
वाष्प का दबाव | 1.85E-05mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |