Chemindex > 22560-21-0
IN ▼
22560-21-0 Potassium triethylborohydride |
|
| उत्पाद का नाम | Potassium triethylborohydride |
| अंग्रेज | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| आणविक फार्मूला | C6H16BK |
| आण्विक वजन | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| कैस रजिस्टी संख्या | 22560-21-0 |
| EINECS | 245-077-3 |
| आणविक संरचना |  |
| खतरा प्रतीक |  F##Highly flammable||C##Corrosive:; |
| खतरे के कोड | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| सुरक्षा विवरण | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 