ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23008-56-2 4-Chloro-2'-Nitrodiphenylamine |
|
| उत्पाद का नाम | 4-Chloro-2'-Nitrodiphenylamine |
| अंग्रेज | 4-Chloro-2'-Nitrodiphenylamine;N-(4-Chlorophenyl)-2-nitroaniline;4-chloro-N-(2-nitrophenyl) benzenamine |
| आणविक फार्मूला | C12H9ClN2O2 |
| आण्विक वजन | 248.6651 |
| InChI | InChI=1/C12H9ClN2O2/c13-9-5-7-10(8-6-9)14-11-3-1-2-4-12(11)15(16)17/h1-8,14H |
| कैस रजिस्टी संख्या | 23008-56-2 |
| EINECS | 245-377-4 |
| आणविक संरचना | ![]() |
| घनत्व | 1.387g/cm3 |
| उबलने का समय | 377.2°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.671 |
| फ्लैश प्वाइंट | 181.9°C |
| वाष्प का दबाव | 6.86E-06mmHg at 25°C |
| MSDS | |