ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26694-70-2 3,6-बीआईएस (एथिलमिनो) -9- [ओ- (मेथॉक्सीकार्बोनिल) फिनाइल] -2,7-डाइमिथाइलक्सैन्थिलियम हाइड्रोजन कार्बोनेट |
|
| उत्पाद का नाम | 3,6-बीआईएस (एथिलमिनो) -9- [ओ- (मेथॉक्सीकार्बोनिल) फिनाइल] -2,7-डाइमिथाइलक्सैन्थिलियम हाइड्रोजन कार्बोनेट |
| समानार्थी | ज़ैंथिलियम, 3,6-बीआईएस (एथिलमिनो) -9- (2- (मेथॉक्सीकार्बोनिल) फिनाइल) -2,7-डाइमिथाइल-, कार्बोनेट (1: 1); 3,6-बिस (एथिलमिनो) -9- (ओ- (मेथॉक्सीकार्बोनिल) फिनाइल) -2,7-डाइमिथाइलक्सैन्थिलियम हाइड्रोजन कार्बोनेट; एन- {(3ई) -6- (एथिलमिनो) -9- [2- (मेथॉक्सीकार्बोनिल) फिनाइल] -2,7-डाइमिथाइल-3 एच-ज़ैंथेन-3-यलिडीन} एथेनामिनियम हाइड्रोजन कार्बोनेट; |
| अंग्रेज | 3,6-bis(ethylamino)-9-[o-(methoxycarbonyl)phenyl]-2,7-dimethylxanthylium hydrogen carbonate;Xanthylium, 3,6-bis(ethylamino)-9-(2-(methoxycarbonyl)phenyl)-2,7-dimethyl-, carbonate (1:1);3,6-Bis(ethylamino)-9-(o-(methoxycarbonyl)phenyl)-2,7-dimethylxanthylium hydrogen carbonate;N-{(3E)-6-(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-3H-xanthen-3-ylidene}ethanaminium hydrogen carbonate |
| आणविक फार्मूला | C28H30N2O6 |
| आण्विक वजन | 490.5476 |
| InChI | InChI=1/C27H29N2O3.CH2O3/c1-6-28-22-14-24-20(12-16(22)3)26(18-10-8-9-11-19(18)27(30)31-5)21-13-17(4)23(29-7-2)15-25(21)32-24;2-1(3)4/h8-15,28-29H,6-7H2,1-5H3;(H2,2,3,4)/q+1;/p-1 |
| कैस रजिस्टी संख्या | 26694-70-2 |
| EINECS | 247-908-5 |
| आणविक संरचना | ![]() |
| MSDS | |