Chemindex > 27151-57-1
IN ▼
27151-57-1 4,4'-Dimethoxy-N-methyldiphenylamine |
|
| उत्पाद का नाम | 4,4'-Dimethoxy-N-methyldiphenylamine |
| अंग्रेज | 4,4'-Dimethoxy-N-methyldiphenylamine;N-(4-Methoxyphenyl)-N-methyl-p-anisidine;4-methoxy-N-(4-methoxyphenyl)-N-methylaniline |
| आणविक फार्मूला | C15H17NO2 |
| आण्विक वजन | 243.301 |
| InChI | InChI=1/C15H17NO2/c1-16(12-4-8-14(17-2)9-5-12)13-6-10-15(18-3)11-7-13/h4-11H,1-3H3 |
| कैस रजिस्टी संख्या | 27151-57-1 |
| EINECS | 248-265-3 |
| आणविक संरचना |  |
| घनत्व | 1.095g/cm3 |
| उबलने का समय | 387.3°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.578 |
| फ्लैश प्वाइंट | 145.9°C |
| वाष्प का दबाव | 3.32E-06mmHg at 25°C |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
27151-57-1 (0) के लिए आपूर्तिकर्ता:
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 