ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
| उत्पाद का नाम | Monoethylpimelate |
| अंग्रेज | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
| आणविक फार्मूला | C9H16O4 |
| आण्विक वजन | 188.2209 |
| InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| कैस रजिस्टी संख्या | 33018-91-6 |
| EINECS | 251-346-6 |
| आणविक संरचना | ![]() |
| घनत्व | 1.074g/cm3 |
| उबलने का समय | 288.7°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.449 |
| फ्लैश प्वाइंट | 108°C |
| वाष्प का दबाव | 0.000581mmHg at 25°C |
| खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |