ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42601-04-7 3,4-Difluorophenyl isocyanate |
|
उत्पाद का नाम | 3,4-Difluorophenyl isocyanate |
अंग्रेज | 3,4-Difluorophenyl isocyanate;1,2-difluoro-4-isocyanatobenzene |
आणविक फार्मूला | C7H3F2NO |
आण्विक वजन | 155.1016 |
InChI | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
कैस रजिस्टी संख्या | 42601-04-7 |
आणविक संरचना | ![]() |
घनत्व | 1.24g/cm3 |
उबलने का समय | 186.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.488 |
फ्लैश प्वाइंट | 58.9°C |
वाष्प का दबाव | 0.665mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |