ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
| उत्पाद का नाम | 1-Chloro-3-fluoro-2-propanol |
| अंग्रेज | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
| आणविक फार्मूला | C3H6ClFO |
| आण्विक वजन | 112.5305 |
| InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| कैस रजिस्टी संख्या | 453-11-2 |
| आणविक संरचना | ![]() |
| घनत्व | 1.212g/cm3 |
| उबलने का समय | 158.1°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.399 |
| फ्लैश प्वाइंट | 49.4°C |
| वाष्प का दबाव | 0.951mmHg at 25°C |
| खतरे के कोड | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |