ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| उत्पाद का नाम | 1-(4-fluorophenyl)-2-thiourea |
| अंग्रेज | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| आणविक फार्मूला | C7H7FN2S |
| आण्विक वजन | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| कैस रजिस्टी संख्या | 459-05-2 |
| आणविक संरचना | ![]() |
| घनत्व | 1.397g/cm3 |
| गलनांक | 164℃ |
| उबलने का समय | 264.2°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.692 |
| फ्लैश प्वाइंट | 113.6°C |
| वाष्प का दबाव | 0.00987mmHg at 25°C |
| खतरे के कोड | R25##Toxic if swallowed.:; |
| सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |