ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5412-69-1 5-Diethylamino-2-pentanol |
|
उत्पाद का नाम | 5-Diethylamino-2-pentanol |
अंग्रेज | 5-Diethylamino-2-pentanol;5-Diethylaminopentan-2-ol;(4S)-N,N-diethyl-4-hydroxypentan-1-aminium;(4R)-N,N-diethyl-4-hydroxypentan-1-aminium |
आणविक फार्मूला | C9H22NO |
आण्विक वजन | 160.2765 |
InChI | InChI=1/C9H21NO/c1-4-10(5-2)8-6-7-9(3)11/h9,11H,4-8H2,1-3H3/p+1/t9-/m1/s1 |
कैस रजिस्टी संख्या | 5412-69-1 |
EINECS | 226-497-6 |
आणविक संरचना | ![]() |
उबलने का समय | 218.6°C at 760 mmHg |
फ्लैश प्वाइंट | 70.2°C |
वाष्प का दबाव | 0.0264mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |