ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55618-66-1 1,1'- {बाइफिनाइल-4,4'-डायलबिस [(2ई) -3-मिथाइलबट-2-एनई-4,1-डायल]}बीआईएस [1- (2-मेथॉक्सी-2-ऑक्सोएथिल) पाइपरिडिनियम] डाइक्लोराइड |
|
| उत्पाद का नाम | 1,1'- {बाइफिनाइल-4,4'-डायलबिस [(2ई) -3-मिथाइलबट-2-एनई-4,1-डायल]}बीआईएस [1- (2-मेथॉक्सी-2-ऑक्सोएथिल) पाइपरिडिनियम] डाइक्लोराइड |
| समानार्थी | ; |
| अंग्रेज | 1,1'-{biphenyl-4,4'-diylbis[(2E)-3-methylbut-2-ene-4,1-diyl]}bis[1-(2-methoxy-2-oxoethyl)piperidinium] dichloride; |
| आणविक फार्मूला | C38H54Cl2N2O4 |
| आण्विक वजन | 673.7524 |
| InChI | InChI=1/C38H54N2O4.2ClH/c1-31(19-25-39(29-37(41)43-3)21-7-5-8-22-39)27-33-11-15-35(16-12-33)36-17-13-34(14-18-36)28-32(2)20-26-40(30-38(42)44-4)23-9-6-10-24-40;;/h11-20H,5-10,21-30H2,1-4H3;2*1H/q+2;;/p-2/b31-19+,32-20+;; |
| कैस रजिस्टी संख्या | 55618-66-1 |
| आणविक संरचना | ![]() |
| MSDS | |