ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-55-9 4-Heptanol |
|
| उत्पाद का नाम | 4-Heptanol |
| अंग्रेज | 4-Heptanol;Dipropylcarbinol;heptan-4-ol |
| आणविक फार्मूला | C7H16O |
| आण्विक वजन | 116.2013 |
| InChI | InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| कैस रजिस्टी संख्या | 589-55-9 |
| EINECS | 209-651-7 |
| आणविक संरचना | ![]() |
| घनत्व | 0.818g/cm3 |
| उबलने का समय | 161.3°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.42 |
| फ्लैश प्वाइंट | 61.8°C |
| वाष्प का दबाव | 0.792mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R10##Flammable.||R36##Irritating to eyes.:; |
| सुरक्षा विवरण | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
| MSDS | |