ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6240-57-9 3- [(जेड) - {3- [2- (3,4-डाइमेथॉक्सीफेनिल) एथिल] -4-ऑक्सो-2-थियोक्सो-1,3-थियाज़ोलिडिन-5-यलिडीन}मिथाइल] क्विनोलिन -2 (1 एच) -एक |
|
| उत्पाद का नाम | 3- [(जेड) - {3- [2- (3,4-डाइमेथॉक्सीफेनिल) एथिल] -4-ऑक्सो-2-थियोक्सो-1,3-थियाज़ोलिडिन-5-यलिडीन}मिथाइल] क्विनोलिन -2 (1 एच) -एक |
| समानार्थी | ;(5Z) -3- [2- (3,4-डाइमेथॉक्सीफेनिल) एथिल] -5 - [(2-हाइड्रॉक्सीक्विनोलिन -3-वाईएल) मेथिलीन] -2-थियोक्सो -1,3-थियाज़ोलिडिन-4-एक; 4-थियाज़ोलिडिनोन, 3- [2- (3,4-डाइमेथॉक्सीफेनिल) एथिल] -5 - [(2-हाइड्रॉक्सी-3-क्विनोलिनिल) मेथिलीन] -2-थियोक्सो-, (5Z) -; |
| अंग्रेज | 3-[(Z)-{3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene}methyl]quinolin-2(1H)-one;(5Z)-3-[2-(3,4-Dimethoxyphenyl)ethyl]-5-[(2-hydroxyquinolin-3-yl)methylene]-2-thioxo-1,3-thiazolidin-4-one;4-thiazolidinone, 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(2-hydroxy-3-quinolinyl)methylene]-2-thioxo-, (5Z)- |
| आणविक फार्मूला | C23H20N2O4S2 |
| आण्विक वजन | 452.5459 |
| InChI | InChI=1/C23H20N2O4S2/c1-28-18-8-7-14(11-19(18)29-2)9-10-25-22(27)20(31-23(25)30)13-16-12-15-5-3-4-6-17(15)24-21(16)26/h3-8,11-13H,9-10H2,1-2H3,(H,24,26)/b20-13- |
| कैस रजिस्टी संख्या | 6240-57-9 |
| आणविक संरचना | ![]() |
| घनत्व | 1.43g/cm3 |
| अपवर्तक सूचकांक | 1.714 |
| MSDS | |