ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine |
|
उत्पाद का नाम | (S)-1-(4-Fluorophenyl)ethylamine |
अंग्रेज | (S)-1-(4-Fluorophenyl)ethylamine;(S)-(-)-1-(4-Fluorophenyl)ethylamine;(S)-4-Fluoro-alpha-methylbenzylamine;1-bromo-2,3,4-trichloro-1,1,2-trifluorobutane;(1S)-1-(4-fluorophenyl)ethanamine |
आणविक फार्मूला | C8H10FN |
आण्विक वजन | 139.1701 |
InChI | InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m0/s1 |
कैस रजिस्टी संख्या | 66399-30-2 |
आणविक संरचना | ![]() |
घनत्व | 1.063g/cm3 |
उबलने का समय | 185.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.512 |
फ्लैश प्वाइंट | 74°C |
वाष्प का दबाव | 0.698mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |