ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-23-1 2-Hydroxy-6-methoxyacetophenone |
|
| उत्पाद का नाम | 2-Hydroxy-6-methoxyacetophenone |
| अंग्रेज | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
| आणविक फार्मूला | C9H10O3 |
| आण्विक वजन | 166.1739 |
| InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| कैस रजिस्टी संख्या | 703-23-1 |
| EINECS | 211-872-9 |
| आणविक संरचना | ![]() |
| घनत्व | 1.158g/cm3 |
| गलनांक | 58-60℃ |
| उबलने का समय | 259.5°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.537 |
| फ्लैश प्वाइंट | 108.1°C |
| वाष्प का दबाव | 0.00798mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |