ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70682-65-4 हे, ओ-बीआईएस (सेकंड-ब्यूटाइल) हाइड्रोजन डाइथियोफॉस्फेट, डायसाइक्लोहेक्सिलामाइन (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | हे, ओ-बीआईएस (सेकंड-ब्यूटाइल) हाइड्रोजन डाइथियोफॉस्फेट, डायसाइक्लोहेक्सिलामाइन (1: 1) के साथ यौगिक |
समानार्थी | फॉस्फोरोडिथियोइक एसिड, ओ, ओ-बीआईएस (1-मिथाइलप्रोपाइल) एस्टर, कॉम्प।एन-साइक्लोहेक्सिलसाइक्लोहेक्सानामाइन (1: 1) के साथ; ओ, ओ-बिस (1-मिथाइलप्रोपाइल) डाइथियोफॉस्फेट, डाइसाइक्लोहेक्सिलामाइन नमक; ओ, ओ-बिस (सेक-ब्यूटाइल) हाइड्रोजन डाइथियोफॉस्फेट, डायसाइक्लोहेक्सिलामाइन (1: 1) के साथ यौगिक; ओ, ओ-डिबुटन-2-वाईएल हाइड्रोजन फॉस्फोरोडिथियोएट - एन-साइक्लोहेक्सिलसाइक्लोहेक्सानामाइन (1: 1); |
अंग्रेज | O,O-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);Phosphorodithioic acid, O,O-bis(1-methylpropyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1);O,O-Bis(1-methylpropyl) dithiophosphate, dicyclohexylamine salt;O,O-Bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);O,O-dibutan-2-yl hydrogen phosphorodithioate - N-cyclohexylcyclohexanamine (1:1) |
आणविक फार्मूला | C20H42NO2PS2 |
आण्विक वजन | 423.6567 |
InChI | InChI=1/C12H23N.C8H19O2PS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3)9-11(12,13)10-8(4)6-2/h11-13H,1-10H2;7-8H,5-6H2,1-4H3,(H,12,13) |
कैस रजिस्टी संख्या | 70682-65-4 |
EINECS | 274-745-7 |
आणविक संरचना | ![]() |
उबलने का समय | 256.1°C at 760 mmHg |
फ्लैश प्वाइंट | 96.1°C |
वाष्प का दबाव | 0.0157mmHg at 25°C |
MSDS |