ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71642-16-5 3-Methyl-2,4,6-tribromoaniline |
|
उत्पाद का नाम | 3-Methyl-2,4,6-tribromoaniline |
अंग्रेज | 3-Methyl-2,4,6-tribromoaniline;2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine;2,4,6-Tribromo-m-toluidine;2,4,6-tribromo-3-methylaniline |
आणविक फार्मूला | C7H6Br3N |
आण्विक वजन | 343.8412 |
InChI | InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
कैस रजिस्टी संख्या | 71642-16-5 |
आणविक संरचना | ![]() |
घनत्व | 2.196g/cm3 |
गलनांक | 101-102℃ |
उबलने का समय | 314.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.668 |
फ्लैश प्वाइंट | 143.8°C |
वाष्प का दबाव | 0.000475mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |