ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
| उत्पाद का नाम | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| अंग्रेज | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| आणविक फार्मूला | C14H10Cl4 |
| आण्विक वजन | 320.04 |
| InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| कैस रजिस्टी संख्या | 72-54-8 |
| EINECS | 200-783-0 |
| आणविक संरचना | ![]() |
| गलनांक | 109-111℃ |
| खतरा प्रतीक | |
| खतरे के कोड | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |