ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
| उत्पाद का नाम | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| अंग्रेज | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
| आणविक फार्मूला | C14H8Cl4 |
| आण्विक वजन | 318.02 |
| InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| कैस रजिस्टी संख्या | 72-55-9 |
| EINECS | 200-784-6 |
| आणविक संरचना | ![]() |
| गलनांक | 87-90℃ |
| पानी की विलेयता | 0.00000013 g/100 mL |
| खतरा प्रतीक | |
| खतरे के कोड | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
| सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |