ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
उत्पाद का नाम | 2-Chlorobutyryl chloride |
अंग्रेज | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
आणविक फार्मूला | C4H6Cl2O |
आण्विक वजन | 140.9958 |
InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
कैस रजिस्टी संख्या | 7623-11-2 |
आणविक संरचना | ![]() |
घनत्व | 1.227g/cm3 |
उबलने का समय | 130.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.44 |
फ्लैश प्वाइंट | 53.2°C |
वाष्प का दबाव | 9.68mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |