ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
उत्पाद का नाम | 3,5-Dimethylphenylthiourea |
अंग्रेज | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
आणविक फार्मूला | C9H12N2S |
आण्विक वजन | 180.27 |
InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
कैस रजिस्टी संख्या | 97480-60-9 |
आणविक संरचना | ![]() |
घनत्व | 1.2g/cm3 |
उबलने का समय | 293.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.674 |
फ्लैश प्वाइंट | 131.5°C |
वाष्प का दबाव | 0.00168mmHg at 25°C |
खतरे के कोड | R25##Toxic if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |