ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
نام محصول | 3-Hydroxyphenylacetylene |
نام انگلیسی | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
میدان مغناطیسی | C8H6O |
وزن مولکولی | 118.1326 |
InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
شماره سیایاس | 10401-11-3 |
ساختار مولکولی | ![]() |
تراکم | 1.12g/cm3 |
نقطه غلیان | 230.9°C at 760 mmHg |
ضریب شکست | 1.589 |
نقطه اشتعال | 106.1°C |
فشار بخار | 0.0424mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |