ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14883-87-5 DL-3,4-Dihydroxymandelic acid |
|
نام محصول | DL-3,4-Dihydroxymandelic acid |
نام انگلیسی | DL-3,4-Dihydroxymandelic acid;(1)-3,4-Dihydroxyphenylglycolic acid;(3,4-dihydroxyphenyl)(hydroxy)acetic acid;(2S)-(3,4-dihydroxyphenyl)(hydroxy)ethanoate;(2R)-(3,4-dihydroxyphenyl)(hydroxy)ethanoate |
میدان مغناطیسی | C8H7O5 |
وزن مولکولی | 183.1387 |
InChI | InChI=1/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)/p-1/t7-/m1/s1 |
شماره سیایاس | 14883-87-5 |
تعداد کمیسیون اروپایی | 238-956-8 |
ساختار مولکولی | ![]() |
نقطه ذوب | 133-137℃ |
نقطه غلیان | 487.5°C at 760 mmHg |
نقطه اشتعال | 262.7°C |
فشار بخار | 2.57E-10mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |