ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1556-18-9 Iodocyclopentane |
|
نام محصول | Iodocyclopentane |
نام انگلیسی | Iodocyclopentane;Iodocyclopentane (Cyclopentyl iodide);Cyclopentyl iodide;1-isothiocyanato-3-methoxybenzene |
میدان مغناطیسی | C8H7NOS |
وزن مولکولی | 165.2123 |
InChI | InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
شماره سیایاس | 1556-18-9 |
تعداد کمیسیون اروپایی | 216-311-1 |
ساختار مولکولی | ![]() |
تراکم | 1.08g/cm3 |
نقطه غلیان | 280.5°C at 760 mmHg |
ضریب شکست | 1.551 |
نقطه اشتعال | 123.4°C |
فشار بخار | 0.00642mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |