ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
15822-77-2 1-(2-nitrophenyl)piperidine |
|
نام محصول | 1-(2-nitrophenyl)piperidine |
نام انگلیسی | 1-(2-nitrophenyl)piperidine;1-(2-Nitrophenyl)piperidine;1-(O-Nitrophenyl)piperidine;Piperidine, 1-(2-nitrophenyl)- |
میدان مغناطیسی | C11H14N2O2 |
وزن مولکولی | 206.2411 |
InChI | InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
شماره سیایاس | 15822-77-2 |
ساختار مولکولی | ![]() |
تراکم | 1.188g/cm3 |
نقطه ذوب | 77℃ |
نقطه غلیان | 337.7°C at 760 mmHg |
ضریب شکست | 1.578 |
نقطه اشتعال | 158°C |
فشار بخار | 0.000103mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |