ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
161446-90-8 3-Chloro-4-fluorobenzyl alcohol |
|
نام محصول | 3-Chloro-4-fluorobenzyl alcohol |
نام انگلیسی | 3-Chloro-4-fluorobenzyl alcohol;(3-chloro-4-fluorophenyl)methanol;3-Chloro-4-fluorobenzyla alcohol |
میدان مغناطیسی | C7H6ClFO |
وزن مولکولی | 160.5733 |
InChI | InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
شماره سیایاس | 161446-90-8 |
ساختار مولکولی | ![]() |
تراکم | 1.344g/cm3 |
نقطه غلیان | 242.5°C at 760 mmHg |
ضریب شکست | 1.542 |
نقطه اشتعال | 100.4°C |
فشار بخار | 0.0183mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |