ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21327-86-6 2-Chloro-6-Methylbenzoic Acid |
|
نام محصول | 2-Chloro-6-Methylbenzoic Acid |
نام انگلیسی | 2-Chloro-6-Methylbenzoic Acid;6-Chloro-o-toluic acid (COOH=1);6-Chloro-o-toluic acid;Benzoic acid,2-chloro-6-methyl-;2-Choro-6-methyl-benzoic acid |
میدان مغناطیسی | C8H7ClO2 |
وزن مولکولی | 170.593 |
InChI | InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
شماره سیایاس | 21327-86-6 |
ساختار مولکولی | ![]() |
تراکم | 1.31g/cm3 |
نقطه غلیان | 289.9°C at 760 mmHg |
ضریب شکست | 1.573 |
نقطه اشتعال | 129.2°C |
فشار بخار | 0.000984mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |