ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2142-70-3 2-Iodoacetophenone |
|
نام محصول | 2-Iodoacetophenone |
نام انگلیسی | 2-Iodoacetophenone;2'-iodoacetophenone;1-(2-iodophenyl)ethanone;Iodoacetophenone, 2'- |
میدان مغناطیسی | C8H7IO |
وزن مولکولی | 246.045 |
InChI | InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
شماره سیایاس | 2142-70-3 |
ساختار مولکولی | ![]() |
تراکم | 1.72g/cm3 |
نقطه غلیان | 268.2°C at 760 mmHg |
ضریب شکست | 1.603 |
نقطه اشتعال | 116°C |
فشار بخار | 0.00779mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |