Chemindex > 22560-21-0
IR ▼
22560-21-0 Potassium triethylborohydride |
|
| نام محصول | Potassium triethylborohydride |
| نام انگلیسی | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| میدان مغناطیسی | C6H16BK |
| وزن مولکولی | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| شماره سیایاس | 22560-21-0 |
| تعداد کمیسیون اروپایی | 245-077-3 |
| ساختار مولکولی |  |
| خطر نمادها |  F##Highly flammable||C##Corrosive:; |
| کدهای خطر | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| توضیحات ایمنی | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
- اگر قصد دارید مواد شیمیایی را از چین تهیه کنید، فقط به مرکز خرید ChemNet بروید، ما آخرین و رقابتی ترین قیمت را از تولید کنندگان چینی برای شما دریافت خواهیم کرد.لطفا به
ChemNet Mall مراجعه کنید
خدمات پایگاه داده CAS شیمیایی توسط ChemIndex 