ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine | 
    |
| نام محصول | Acridine | 
| نام انگلیسی | Acridine;Dibenzo[b,e]pyridine | 
| میدان مغناطیسی | C13H9N | 
| وزن مولکولی | 179.2173 | 
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H | 
| شماره سیایاس | 260-94-6 | 
| تعداد کمیسیون اروپایی | 205-971-6 | 
| ساختار مولکولی | ![]()  | 
    
| تراکم | 1.187g/cm3 | 
| نقطه ذوب | 105-110℃ | 
| نقطه غلیان | 346.7°C at 760 mmHg | 
| ضریب شکست | 1.726 | 
| نقطه اشتعال | 153.8°C | 
| فشار بخار | 0.000113mmHg at 25°C | 
| خطر نمادها | |
| کدهای خطر | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |