ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27151-57-1 4,4'-Dimethoxy-N-methyldiphenylamine |
|
نام محصول | 4,4'-Dimethoxy-N-methyldiphenylamine |
نام انگلیسی | 4,4'-Dimethoxy-N-methyldiphenylamine;N-(4-Methoxyphenyl)-N-methyl-p-anisidine;4-methoxy-N-(4-methoxyphenyl)-N-methylaniline |
میدان مغناطیسی | C15H17NO2 |
وزن مولکولی | 243.301 |
InChI | InChI=1/C15H17NO2/c1-16(12-4-8-14(17-2)9-5-12)13-6-10-15(18-3)11-7-13/h4-11H,1-3H3 |
شماره سیایاس | 27151-57-1 |
تعداد کمیسیون اروپایی | 248-265-3 |
ساختار مولکولی | ![]() |
تراکم | 1.095g/cm3 |
نقطه غلیان | 387.3°C at 760 mmHg |
ضریب شکست | 1.578 |
نقطه اشتعال | 145.9°C |
فشار بخار | 3.32E-06mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |