ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-53-3 Iodoacetic acid, sodium salt |
|
| نام محصول | Iodoacetic acid, sodium salt |
| نام انگلیسی | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
| میدان مغناطیسی | C2H2INaO2 |
| وزن مولکولی | 207.9303 |
| InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| شماره سیایاس | 305-53-3 |
| تعداد کمیسیون اروپایی | 206-165-7 |
| ساختار مولکولی | ![]() |
| نقطه ذوب | 208-210℃ |
| نقطه غلیان | 262.1°C at 760 mmHg |
| نقطه اشتعال | 112.3°C |
| فشار بخار | 0.00329mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |