ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
نام محصول | Monoethylpimelate |
نام انگلیسی | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
میدان مغناطیسی | C9H16O4 |
وزن مولکولی | 188.2209 |
InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
شماره سیایاس | 33018-91-6 |
تعداد کمیسیون اروپایی | 251-346-6 |
ساختار مولکولی | ![]() |
تراکم | 1.074g/cm3 |
نقطه غلیان | 288.7°C at 760 mmHg |
ضریب شکست | 1.449 |
نقطه اشتعال | 108°C |
فشار بخار | 0.000581mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |