ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39084-88-3 2,2-dichloro-N-(2,6-dimethylphenyl)acetamide |
|
| نام محصول | 2,2-dichloro-N-(2,6-dimethylphenyl)acetamide |
| نام انگلیسی | 2,2-dichloro-N-(2,6-dimethylphenyl)acetamide; |
| میدان مغناطیسی | C10H11Cl2NO |
| وزن مولکولی | 232.1064 |
| InChI | InChI=1/C10H11Cl2NO/c1-6-4-3-5-7(2)8(6)13-10(14)9(11)12/h3-5,9H,1-2H3,(H,13,14) |
| شماره سیایاس | 39084-88-3 |
| ساختار مولکولی | ![]() |
| تراکم | 1.302g/cm3 |
| نقطه غلیان | 325.3°C at 760 mmHg |
| ضریب شکست | 1.586 |
| نقطه اشتعال | 150.5°C |
| فشار بخار | 0.000233mmHg at 25°C |
| MSDS | |