ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
| نام محصول | 1-(3-fluorophenyl)ethanol |
| نام انگلیسی | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| میدان مغناطیسی | C8H9FO |
| وزن مولکولی | 140.1549 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| شماره سیایاس | 402-63-1 |
| تعداد کمیسیون اروپایی | 206-950-4 |
| ساختار مولکولی | ![]() |
| تراکم | 1.123g/cm3 |
| نقطه غلیان | 196.2°C at 760 mmHg |
| ضریب شکست | 1.51 |
| نقطه اشتعال | 90.1°C |
| فشار بخار | 0.251mmHg at 25°C |
| توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |