ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-64-2 3-fluorobenzal chloride |
|
| نام محصول | 3-fluorobenzal chloride |
| نام انگلیسی | 3-fluorobenzal chloride;alpha,alpha-Dichloro-3-fluorotoluene |
| میدان مغناطیسی | C7H5Cl2F |
| وزن مولکولی | 179.02 |
| InChI | InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
| شماره سیایاس | 402-64-2 |
| تعداد کمیسیون اروپایی | 206-952-5 |
| ساختار مولکولی | ![]() |
| نقطه غلیان | 195℃ |
| کدهای خطر | R34##Causes burns.||R36##Irritating to eyes.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |