ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
نام محصول | 2-Chlorophenoxyacetonitrile |
نام انگلیسی | 2-Chlorophenoxyacetonitrile; |
میدان مغناطیسی | C8H6ClNO |
وزن مولکولی | 167.5923 |
InChI | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
شماره سیایاس | 43111-31-5 |
ساختار مولکولی | ![]() |
تراکم | 1.238g/cm3 |
نقطه غلیان | 276.7°C at 760 mmHg |
ضریب شکست | 1.538 |
نقطه اشتعال | 121.2°C |
فشار بخار | 0.00472mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |