ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4653-08-1 3-(2-thenoyl)propionic acid | 
    |
| نام محصول | 3-(2-thenoyl)propionic acid | 
| نام انگلیسی | 3-(2-thenoyl)propionic acid;4-Oxo-4-(2-thienyl)butyric acid;4-oxo-4-(thiophen-2-yl)butanoic acid;4-oxo-4-thiophen-2-ylbutanoate | 
| میدان مغناطیسی | C8H7O3S | 
| وزن مولکولی | 183.2049 | 
| InChI | InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 | 
| شماره سیایاس | 4653-08-1 | 
| تعداد کمیسیون اروپایی | 225-089-5 | 
| ساختار مولکولی | ![]()  | 
    
| نقطه غلیان | 400.5°C at 760 mmHg | 
| نقطه اشتعال | 196°C | 
| فشار بخار | 3.93E-07mmHg at 25°C | 
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |