ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
497-03-0 2-methyl-2-butenal |
|
نام محصول | 2-methyl-2-butenal |
نام انگلیسی | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
میدان مغناطیسی | C5H8O |
وزن مولکولی | 84.11 |
InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
شماره سیایاس | 497-03-0 |
تعداد کمیسیون اروپایی | 207-833-0 |
ساختار مولکولی | ![]() |
تراکم | 0.871 |
نقطه غلیان | 115-118℃ (752 torr) |
ضریب شکست | 1.447 |
نقطه اشتعال | 18℃ |
خطر نمادها | |
کدهای خطر | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |