ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-18-3 Triethylenemelamine |
|
| نام محصول | Triethylenemelamine |
| نام انگلیسی | Triethylenemelamine;Tretamine;2,4,6-tri(aziridin-1-yl)-1,3,5-triazine;2,4,6-Tris(1-aziridinyl)-s-triazine;TEM;2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| میدان مغناطیسی | C9H12N6 |
| وزن مولکولی | 204.2318 |
| InChI | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| شماره سیایاس | 51-18-3 |
| تعداد کمیسیون اروپایی | 200-083-5 |
| ساختار مولکولی | ![]() |
| تراکم | 1.617g/cm3 |
| نقطه ذوب | 160℃ |
| نقطه غلیان | 430.2°C at 760 mmHg |
| ضریب شکست | 1.789 |
| نقطه اشتعال | 214°C |
| فشار بخار | 1.32E-07mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R28##Very toxic if swallowed.||R40##Possible risks of irreversible effects.:; |
| توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |