ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-49-0 D-Thyroxine |
|
| نام محصول | D-Thyroxine |
| نام انگلیسی | D-Thyroxine;D-4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzylalanine;D-thyroxine free acid;O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine;O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine |
| میدان مغناطیسی | C16H13I4NO4 |
| وزن مولکولی | 790.8966 |
| InChI | InChI=1/C16H13I4NO4/c1-7(16(23)24)21-6-8-2-12(19)15(13(20)3-8)25-9-4-10(17)14(22)11(18)5-9/h2-5,7,21-22H,6H2,1H3,(H,23,24)/t7-/m1/s1 |
| شماره سیایاس | 51-49-0 |
| تعداد کمیسیون اروپایی | 200-102-7 |
| ساختار مولکولی | ![]() |
| نقطه ذوب | 225℃ |
| ضریب شکست | 1.759 |
| خطر نمادها | |
| کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |