ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54778-21-1 2-chloro-1-methyl-1H-indole-3-carboxylic acid؛ ؛ 1H-ایندول-3-کربوکسیلیک اسید، 2-کلرو-1-متیل-؛ 2-Chloro-1-methyl-1H-indole-3-کربوکسیلیک اسید؛ |
|
| نام محصول | 2-chloro-1-methyl-1H-indole-3-carboxylic acid؛ ؛ 1H-ایندول-3-کربوکسیلیک اسید، 2-کلرو-1-متیل-؛ 2-Chloro-1-methyl-1H-indole-3-کربوکسیلیک اسید؛ |
| نام انگلیسی | 2-chloro-1-methyl-1H-indole-3-carboxylic acid;1H-indole-3-carboxylic acid, 2-chloro-1-methyl-;2-Chloro-1-methyl-1H-indole-3-carboxylic acid |
| میدان مغناطیسی | C10H8ClNO2 |
| وزن مولکولی | 209.629 |
| InChI | InChI=1/C10H8ClNO2/c1-12-7-5-3-2-4-6(7)8(9(12)11)10(13)14/h2-5H,1H3,(H,13,14) |
| شماره سیایاس | 54778-21-1 |
| ساختار مولکولی | ![]() |
| تراکم | 1.39g/cm3 |
| نقطه غلیان | 407.7°C at 760 mmHg |
| ضریب شکست | 1.631 |
| نقطه اشتعال | 200.4°C |
| فشار بخار | 2.23E-07mmHg at 25°C |
| MSDS | |