ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
| نام محصول | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| نام انگلیسی | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
| میدان مغناطیسی | C14H8Cl4 |
| وزن مولکولی | 318.02 |
| InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| شماره سیایاس | 72-55-9 |
| تعداد کمیسیون اروپایی | 200-784-6 |
| ساختار مولکولی | ![]() |
| نقطه ذوب | 87-90℃ |
| حلالیت آب | 0.00000013 g/100 mL |
| خطر نمادها | |
| کدهای خطر | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
| توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |