ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75214-12-9 متیل 3-امینو-4- [(1-بنزیل-2-متوکسی-2-اکسوتیل) امینو] -4-اکسوبوتانوات هیدروکلراید؛ متیل (3S) -3-amino-4-{[(1R)-1-benzyl-2-methoxy-2-oxoethyl]amino}-4-oxobutanoate hydrochloride (نام غیر ترجیحی)؛ |
|
نام محصول | متیل 3-امینو-4- [(1-بنزیل-2-متوکسی-2-اکسوتیل) امینو] -4-اکسوبوتانوات هیدروکلراید؛ متیل (3S) -3-amino-4-{[(1R)-1-benzyl-2-methoxy-2-oxoethyl]amino}-4-oxobutanoate hydrochloride (نام غیر ترجیحی)؛ |
نام انگلیسی | methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride;methyl (3S)-3-amino-4-{[(1R)-1-benzyl-2-methoxy-2-oxoethyl]amino}-4-oxobutanoate hydrochloride (non-preferred name) |
میدان مغناطیسی | C15H21ClN2O5 |
وزن مولکولی | 344.7906 |
InChI | InChI=1/C15H20N2O5.ClH/c1-21-13(18)9-11(16)14(19)17-12(15(20)22-2)8-10-6-4-3-5-7-10;/h3-7,11-12H,8-9,16H2,1-2H3,(H,17,19);1H/t11-,12+;/m0./s1 |
شماره سیایاس | 75214-12-9 |
ساختار مولکولی | ![]() |
نقطه ذوب | 65℃ |
نقطه غلیان | 512.2°C at 760 mmHg |
نقطه اشتعال | 263.6°C |
فشار بخار | 1.32E-10mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |