ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7605-25-6 Ethyl (phenylthio)acetate |
|
نام محصول | Ethyl (phenylthio)acetate |
نام انگلیسی | Ethyl (phenylthio)acetate;Ethyl 2-(phenylthio)acetate;ethyl (phenylsulfanyl)acetate;2-(phenylsulfanyl)butanoic acid |
میدان مغناطیسی | C10H12O2S |
وزن مولکولی | 196.2661 |
InChI | InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
شماره سیایاس | 7605-25-6 |
ساختار مولکولی | ![]() |
تراکم | 1.18g/cm3 |
نقطه غلیان | 330.3°C at 760 mmHg |
ضریب شکست | 1.579 |
نقطه اشتعال | 153.5°C |
فشار بخار | 6.74E-05mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |